C28H22N2O4 — CID 2559897
N-(1,3-benzodioxol-5-yl)-2-[(2,2-diphenylacetyl)amino]benzamide (PubChem CID 2559897) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(2,2-diphenylacetyl)amino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(2,2-diphenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 2559897 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(2,2-diphenylacetyl)amino]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccccc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N2O4/c31-27(29-21-15-16-24-25(17-21)34-18-33-24)22-13-7-8-14-23(22)30-28(32)26(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-17,26H,18H2,(H,29,31)(H,30,32) |
| InChIKey | FERHBAQTDPPBQO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |