C20H18N2O7 — CID 168569415
dimethyl (E)-2-[2-(1,3-benzodioxol-5-ylcarbamoyl)anilino]but-2-enedioate (PubChem CID 168569415) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(1,3-benzodioxol-5-ylcarbamoyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(1,3-benzodioxol-5-ylcarbamoyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569415 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | dimethyl (E)-2-[2-(1,3-benzodioxol-5-ylcarbamoyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2)C(=O)OC |
| InChI | InChI=1S/C20H18N2O7/c1-26-18(23)10-15(20(25)27-2)22-14-6-4-3-5-13(14)19(24)21-12-7-8-16-17(9-12)29-11-28-16/h3-10,22H,11H2,1-2H3,(H,21,24)/b15-10+ |
| InChIKey | JKPRSPKBJXGSKT-XNTDXEJSSA-N |
| XLogP | 2.31 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|