C23H16N2O5 — CID 2649687
N-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 2649687) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2649687 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1ccc2c(c1)OCO2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H16N2O5/c26-22(24-15-9-10-19-20(12-15)29-13-28-19)16-6-2-3-7-17(16)25-23(27)21-11-14-5-1-4-8-18(14)30-21/h1-12H,13H2,(H,24,26)(H,25,27) |
| InChIKey | YVEWWRQEHCHCDI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |