C19H16Cl2N2O4 — CID 30093549
N-(1,3-benzodioxol-5-yl)-2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]benzamide (PubChem CID 30093549) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 30093549 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]benzamide |
| SMILES | C[C@]1(C(=O)Nc2ccccc2C(=O)Nc2ccc3c(c2)OCO3)CC1(Cl)Cl |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-18(9-19(18,20)21)17(25)23-13-5-3-2-4-12(13)16(24)22-11-6-7-14-15(8-11)27-10-26-14/h2-8H,9-10H2,1H3,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | WYQBPXNZKCBZKE-GOSISDBHSA-N |
| XLogP | 4.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|