C13H13Cl2N3O3S — CID 2206426
1-(1,3-benzodioxol-5-yl)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiourea (PubChem CID 2206426) has the molecular formula C13H13Cl2N3O3S and a molecular weight of 362.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiourea |
|---|---|
| PubChem CID | 2206426 |
| Molecular Formula | C13H13Cl2N3O3S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]thiourea |
| SMILES | C[C@]1(C(=O)NNC(=S)Nc2ccc3c(c2)OCO3)CC1(Cl)Cl |
| InChI | InChI=1S/C13H13Cl2N3O3S/c1-12(5-13(12,14)15)10(19)17-18-11(22)16-7-2-3-8-9(4-7)21-6-20-8/h2-4H,5-6H2,1H3,(H,17,19)(H2,16,18,22)/t12-/m1/s1 |
| InChIKey | CVZFDAHOTMXVEF-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|