C14H11ClN4O3S — CID 172564048
1-(1,3-benzodioxol-5-yl)-3-[(6-chloropyridine-3-carbonyl)amino]thiourea (PubChem CID 172564048) has the molecular formula C14H11ClN4O3S and a molecular weight of 350.79 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(6-chloropyridine-3-carbonyl)amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(6-chloropyridine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 172564048 |
| Molecular Formula | C14H11ClN4O3S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(6-chloropyridine-3-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc2c(c1)OCO2)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H11ClN4O3S/c15-12-4-1-8(6-16-12)13(20)18-19-14(23)17-9-2-3-10-11(5-9)22-7-21-10/h1-6H,7H2,(H,18,20)(H2,17,19,23) |
| InChIKey | OZNPUCHJUHSPLU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|