C18H13N3O3 — CID 110681883
N-(1,3-benzodioxol-5-yl)-6-pyridin-2-ylpyridine-3-carboxamide (PubChem CID 110681883) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-pyridin-2-ylpyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-pyridin-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 110681883 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-pyridin-2-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C18H13N3O3/c22-18(21-13-5-7-16-17(9-13)24-11-23-16)12-4-6-15(20-10-12)14-3-1-2-8-19-14/h1-10H,11H2,(H,21,22) |
| InChIKey | WNRDSJWBVKJXPV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |