C18H14N4O3 — CID 109265250
2-anilino-N-(1,3-benzodioxol-5-yl)pyrimidine-5-carboxamide (PubChem CID 109265250) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-anilino-N-(1,3-benzodioxol-5-yl)pyrimidine-5-carboxamide.
| Compound Name | 2-anilino-N-(1,3-benzodioxol-5-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109265250 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-anilino-N-(1,3-benzodioxol-5-yl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cnc(Nc2ccccc2)nc1 |
| InChI | InChI=1S/C18H14N4O3/c23-17(21-14-6-7-15-16(8-14)25-11-24-15)12-9-19-18(20-10-12)22-13-4-2-1-3-5-13/h1-10H,11H2,(H,21,23)(H,19,20,22) |
| InChIKey | PAKJPXMNBJCLOR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |