C18H12F2N4O3 — CID 109270447
N-(1,3-benzodioxol-5-yl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide (PubChem CID 109270447) has the molecular formula C18H12F2N4O3 and a molecular weight of 370.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109270447 |
| Molecular Formula | C18H12F2N4O3 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(3,4-difluoroanilino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cnc(Nc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C18H12F2N4O3/c19-13-3-1-11(5-14(13)20)24-18-21-7-10(8-22-18)17(25)23-12-2-4-15-16(6-12)27-9-26-15/h1-8H,9H2,(H,23,25)(H,21,22,24) |
| InChIKey | HXOIETPSKYSMES-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |