C13H8Cl2N2O3 — CID 2471203
N-(1,3-benzodioxol-5-yl)-5,6-dichloropyridine-3-carboxamide (PubChem CID 2471203) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 2471203 |
| Molecular Formula | C13H8Cl2N2O3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O3/c14-9-3-7(5-16-12(9)15)13(18)17-8-1-2-10-11(4-8)20-6-19-10/h1-5H,6H2,(H,17,18) |
| InChIKey | KZBRXYBRJHXPBT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|