C13H9Cl2N3O2 — CID 7760364
N-(4-carbamoylphenyl)-5,6-dichloropyridine-3-carboxamide (PubChem CID 7760364) has the molecular formula C13H9Cl2N3O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 7760364 |
| Molecular Formula | C13H9Cl2N3O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | N-(4-carbamoylphenyl)-5,6-dichloropyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H9Cl2N3O2/c14-10-5-8(6-17-11(10)15)13(20)18-9-3-1-7(2-4-9)12(16)19/h1-6H,(H2,16,19)(H,18,20) |
| InChIKey | COGOOOKHTNCZDU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|