C16H16Cl2N2O — CID 7935724
N-[4-[(2R)-butan-2-yl]phenyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 7935724) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]phenyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]phenyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 7935724 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]phenyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | CC[C@@H](C)c1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-3-10(2)11-4-6-13(7-5-11)20-16(21)12-8-14(17)15(18)19-9-12/h4-10H,3H2,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | ZIVNUFKKOYIVDR-SNVBAGLBSA-N |
| XLogP | 5.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|