C18H13Cl2N3O — CID 46799163
5,6-dichloro-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide (PubChem CID 46799163) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is 5,6-dichloro-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46799163 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5,6-dichloro-N-[4-(pyridin-4-ylmethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2ccncc2)cc1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2N3O/c19-16-10-14(11-22-17(16)20)18(24)23-15-3-1-12(2-4-15)9-13-5-7-21-8-6-13/h1-8,10-11H,9H2,(H,23,24) |
| InChIKey | YHZORJMRZBZDRX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|