C12H5Cl4FN2O — CID 107573379
5,6-dichloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-carboxamide (PubChem CID 107573379) has the molecular formula C12H5Cl4FN2O and a molecular weight of 354.00 g/mol. Its IUPAC name is 5,6-dichloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107573379 |
| Molecular Formula | C12H5Cl4FN2O |
| Molecular Weight | 354.00 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 5,6-dichloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(F)c(Cl)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H5Cl4FN2O/c13-7-2-6(3-8(14)10(7)17)19-12(20)5-1-9(15)11(16)18-4-5/h1-4H,(H,19,20) |
| InChIKey | GPQCSQJSYBSCLT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|