C11H6Cl2FN3O — CID 113462599
5,6-dichloro-N-(6-fluoro-2-pyridinyl)pyridine-3-carboxamide (PubChem CID 113462599) has the molecular formula C11H6Cl2FN3O and a molecular weight of 286.09 g/mol. Its IUPAC name is 5,6-dichloro-N-(6-fluoro-2-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(6-fluoro-2-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113462599 |
| Molecular Formula | C11H6Cl2FN3O |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 5,6-dichloro-N-(6-fluoro-2-pyridinyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)n1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl2FN3O/c12-7-4-6(5-15-10(7)13)11(18)17-9-3-1-2-8(14)16-9/h1-5H,(H,16,17,18) |
| InChIKey | KLLQYFAWUGPYDV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|