C10H5Cl3N4O — CID 114052239
5,6-dichloro-N-(4-chloropyrimidin-2-yl)pyridine-3-carboxamide (PubChem CID 114052239) has the molecular formula C10H5Cl3N4O and a molecular weight of 303.54 g/mol. Its IUPAC name is 5,6-dichloro-N-(4-chloropyrimidin-2-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(4-chloropyrimidin-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114052239 |
| Molecular Formula | C10H5Cl3N4O |
| Molecular Weight | 303.54 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | 5,6-dichloro-N-(4-chloropyrimidin-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nccc(Cl)n1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H5Cl3N4O/c11-6-3-5(4-15-8(6)13)9(18)17-10-14-2-1-7(12)16-10/h1-4H,(H,14,16,17,18) |
| InChIKey | HWGSUKFQJQDFMH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|