C9H12Cl2N2O2 — CID 143700585
5,6-dichloro-N-methoxypyridine-3-carboxamide;ethane (PubChem CID 143700585) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 5,6-dichloro-N-methoxypyridine-3-carboxamide;ethane.
| Compound Name | 5,6-dichloro-N-methoxypyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143700585 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5,6-dichloro-N-methoxypyridine-3-carboxamide;ethane |
| SMILES | CC.CONC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2N2O2.C2H6/c1-13-11-7(12)4-2-5(8)6(9)10-3-4;1-2/h2-3H,1H3,(H,11,12);1-2H3 |
| InChIKey | PQIWAOJWYIIAOP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|