C8H7Cl2NO — CID 89298728
2,3-dichloro-5-(1-methoxyethenyl)pyridine (PubChem CID 89298728) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 2,3-dichloro-5-(1-methoxyethenyl)pyridine.
| Compound Name | 2,3-dichloro-5-(1-methoxyethenyl)pyridine |
|---|---|
| PubChem CID | 89298728 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2,3-dichloro-5-(1-methoxyethenyl)pyridine |
| SMILES | C=C(OC)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO/c1-5(12-2)6-3-7(9)8(10)11-4-6/h3-4H,1H2,2H3 |
| InChIKey | MMJMZLXTFGNLLX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|