About (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate
(4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate (PubChem CID 8881479) has the molecular formula C13H9Cl2NO3
and a molecular weight of 298.13 g/mol. Its IUPAC name is (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate |
| PubChem CID | 8881479 |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H9Cl2NO3/c1-18-9-2-4-10(5-3-9)19-13(17)8-6-11(14)12(15)16-7-8/h2-7H,1H3 |
| InChIKey | NRBJBYUDBDJYJS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate?
The IUPAC name of (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate (CID 8881479) is (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate.
What is the SMILES notation for (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate?
The canonical SMILES for (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate is COc1ccc(OC(=O)c2cnc(Cl)c(Cl)c2)cc1.
What is the InChIKey of (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate?
The InChIKey is NRBJBYUDBDJYJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO3/c1-18-9-2-4-10(5-3-9)19-13(17)8-6-11(14)12(15)16-7-8/h2-7H,1H3.
What are the key properties of (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate?
(4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate has a molecular weight of 298.13 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 5,6-dichloropyridine-3-carboxylate is sourced from PubChem (CID 8881479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).