C15H11Cl2NO5 — CID 4795346
(5-methoxy-2-methoxycarbonylphenyl) 5,6-dichloropyridine-3-carboxylate (PubChem CID 4795346) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is (5-methoxy-2-methoxycarbonylphenyl) 5,6-dichloropyridine-3-carboxylate.
| Compound Name | (5-methoxy-2-methoxycarbonylphenyl) 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 4795346 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (5-methoxy-2-methoxycarbonylphenyl) 5,6-dichloropyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OC)cc1OC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2NO5/c1-21-9-3-4-10(15(20)22-2)12(6-9)23-14(19)8-5-11(16)13(17)18-7-8/h3-7H,1-2H3 |
| InChIKey | ZPNLESQQWVWSCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|