C16H14Cl2O6S — CID 56579059
methyl 2-[(3,4-dichlorophenyl)methylsulfonyloxy]-4-methoxybenzoate (PubChem CID 56579059) has the molecular formula C16H14Cl2O6S and a molecular weight of 405.26 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)methylsulfonyloxy]-4-methoxybenzoate.
| Compound Name | methyl 2-[(3,4-dichlorophenyl)methylsulfonyloxy]-4-methoxybenzoate |
|---|---|
| PubChem CID | 56579059 |
| Molecular Formula | C16H14Cl2O6S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | methyl 2-[(3,4-dichlorophenyl)methylsulfonyloxy]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1OS(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O6S/c1-22-11-4-5-12(16(19)23-2)15(8-11)24-25(20,21)9-10-3-6-13(17)14(18)7-10/h3-8H,9H2,1-2H3 |
| InChIKey | IBAPMZVPHDAMRB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|