C14H9Cl2NO3S — CID 56514564
(4-cyanophenyl) (3,4-dichlorophenyl)methanesulfonate (PubChem CID 56514564) has the molecular formula C14H9Cl2NO3S and a molecular weight of 342.20 g/mol. Its IUPAC name is (4-cyanophenyl) (3,4-dichlorophenyl)methanesulfonate.
| Compound Name | (4-cyanophenyl) (3,4-dichlorophenyl)methanesulfonate |
|---|---|
| PubChem CID | 56514564 |
| Molecular Formula | C14H9Cl2NO3S |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | (4-cyanophenyl) (3,4-dichlorophenyl)methanesulfonate |
| SMILES | N#Cc1ccc(OS(=O)(=O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H9Cl2NO3S/c15-13-6-3-11(7-14(13)16)9-21(18,19)20-12-4-1-10(8-17)2-5-12/h1-7H,9H2 |
| InChIKey | UPTRLZFJSQBSEL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|