C13H6Cl3NO3S — CID 2725580
(4-cyanophenyl) 2,4,5-trichlorobenzenesulfonate (PubChem CID 2725580) has the molecular formula C13H6Cl3NO3S and a molecular weight of 362.62 g/mol. Its IUPAC name is (4-cyanophenyl) 2,4,5-trichlorobenzenesulfonate.
| Compound Name | (4-cyanophenyl) 2,4,5-trichlorobenzenesulfonate |
|---|---|
| PubChem CID | 2725580 |
| Molecular Formula | C13H6Cl3NO3S |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | (4-cyanophenyl) 2,4,5-trichlorobenzenesulfonate |
| SMILES | N#Cc1ccc(OS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H6Cl3NO3S/c14-10-5-12(16)13(6-11(10)15)21(18,19)20-9-3-1-8(7-17)2-4-9/h1-6H |
| InChIKey | AIRCMWWBMDSKHA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|