C16H7Cl3N2O3S — CID 22899706
[3-(2,2-dicyanoethenyl)phenyl] 2,4,5-trichlorobenzenesulfonate (PubChem CID 22899706) has the molecular formula C16H7Cl3N2O3S and a molecular weight of 413.67 g/mol. Its IUPAC name is [3-(2,2-dicyanoethenyl)phenyl] 2,4,5-trichlorobenzenesulfonate.
| Compound Name | [3-(2,2-dicyanoethenyl)phenyl] 2,4,5-trichlorobenzenesulfonate |
|---|---|
| PubChem CID | 22899706 |
| Molecular Formula | C16H7Cl3N2O3S |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | [3-(2,2-dicyanoethenyl)phenyl] 2,4,5-trichlorobenzenesulfonate |
| SMILES | N#CC(C#N)=Cc1cccc(OS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H7Cl3N2O3S/c17-13-6-15(19)16(7-14(13)18)25(22,23)24-12-3-1-2-10(5-12)4-11(8-20)9-21/h1-7H |
| InChIKey | RLZAAWKPRWUDPN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|