C16H8Cl2N2S — CID 155564552
2-[[3-(3,4-dichlorophenyl)sulfanylphenyl]methylidene]propanedinitrile (PubChem CID 155564552) has the molecular formula C16H8Cl2N2S and a molecular weight of 331.23 g/mol. Its IUPAC name is 2-[[3-(3,4-dichlorophenyl)sulfanylphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(3,4-dichlorophenyl)sulfanylphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 155564552 |
| Molecular Formula | C16H8Cl2N2S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-[[3-(3,4-dichlorophenyl)sulfanylphenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cccc(Sc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H8Cl2N2S/c17-15-5-4-14(8-16(15)18)21-13-3-1-2-11(7-13)6-12(9-19)10-20/h1-8H |
| InChIKey | IJZHAGXLNHHMRH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|