C10H6BrCl2N — CID 101407941
(E)-2-(bromomethyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 101407941) has the molecular formula C10H6BrCl2N and a molecular weight of 290.98 g/mol. Its IUPAC name is (E)-2-(bromomethyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(bromomethyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 101407941 |
| Molecular Formula | C10H6BrCl2N |
| Molecular Weight | 290.98 g/mol |
| Exact Mass | 288.91 |
| IUPAC Name | (E)-2-(bromomethyl)-3-(3,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)c(Cl)c1)CBr |
| InChI | InChI=1S/C10H6BrCl2N/c11-5-8(6-14)3-7-1-2-9(12)10(13)4-7/h1-4H,5H2/b8-3- |
| InChIKey | GYANHGRTEZPGRL-BAQGIRSFSA-N |
| XLogP | 4.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|