C14H12Cl2N2O3 — CID 68712881
propan-2-yl N-[2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate (PubChem CID 68712881) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is propan-2-yl N-[2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate.
| Compound Name | propan-2-yl N-[2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate |
|---|---|
| PubChem CID | 68712881 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | propan-2-yl N-[2-cyano-3-(3,4-dichlorophenyl)prop-2-enoyl]carbamate |
| SMILES | CC(C)OC(=O)NC(=O)C(C#N)=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-8(2)21-14(20)18-13(19)10(7-17)5-9-3-4-11(15)12(16)6-9/h3-6,8H,1-2H3,(H,18,19,20) |
| InChIKey | AZWSFHMJRIPUEN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|