C15H14Cl2N2O2 — CID 3118609
2-cyano-3-(3,4-dichlorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 3118609) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dichlorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(3,4-dichlorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3118609 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-cyano-3-(3,4-dichlorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(Cl)c(Cl)c1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-13-4-3-10(7-14(13)17)6-11(8-18)15(20)19-9-12-2-1-5-21-12/h3-4,6-7,12H,1-2,5,9H2,(H,19,20) |
| InChIKey | FKVZAUAAVXPLFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|