C22H20ClN3O3 — CID 7912001
2-chloro-N-[3-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]phenyl]benzamide (PubChem CID 7912001) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7912001 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-chloro-N-[3-[(E)-2-cyano-3-oxo-3-[[(2R)-oxolan-2-yl]methylamino]prop-1-enyl]phenyl]benzamide |
| SMILES | N#C/C(=C\c1cccc(NC(=O)c2ccccc2Cl)c1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C22H20ClN3O3/c23-20-9-2-1-8-19(20)22(28)26-17-6-3-5-15(12-17)11-16(13-24)21(27)25-14-18-7-4-10-29-18/h1-3,5-6,8-9,11-12,18H,4,7,10,14H2,(H,25,27)(H,26,28)/b16-11+/t18-/m1/s1 |
| InChIKey | MSQSOZCBVVQAEA-QIPHDZALSA-N |
| XLogP | 3.79 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|