C15H14N3O5- — CID 7326788
4-[(E)-2-cyano-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-enyl]-2-nitrophenolate (PubChem CID 7326788) has the molecular formula C15H14N3O5- and a molecular weight of 316.29 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-enyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-enyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7326788 |
| Molecular Formula | C15H14N3O5- |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[(E)-2-cyano-3-oxo-3-[[(2S)-oxolan-2-yl]methylamino]prop-1-enyl]-2-nitrophenolate |
| SMILES | N#C/C(=C\c1ccc([O-])c([N+](=O)[O-])c1)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H15N3O5/c16-8-11(15(20)17-9-12-2-1-5-23-12)6-10-3-4-14(19)13(7-10)18(21)22/h3-4,6-7,12,19H,1-2,5,9H2,(H,17,20)/p-1/b11-6+/t12-/m0/s1 |
| InChIKey | QVTPDLRVQSBYEL-BCMYLCSRSA-M |
| XLogP | 0.87 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|