C21H18Cl2N2O4 — CID 126193547
propan-2-yl 2-[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 126193547) has the molecular formula C21H18Cl2N2O4 and a molecular weight of 433.29 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126193547 |
| Molecular Formula | C21H18Cl2N2O4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | propan-2-yl 2-[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O4/c1-13(2)29-20(26)12-28-17-6-3-14(4-7-17)9-15(11-24)21(27)25-19-8-5-16(22)10-18(19)23/h3-10,13H,12H2,1-2H3,(H,25,27)/b15-9- |
| InChIKey | OQWIMGNXPLAVEY-DHDCSXOGSA-N |
| XLogP | 4.87 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|