C19H13Cl2F3N2O3 — CID 86877769
(Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide (PubChem CID 86877769) has the molecular formula C19H13Cl2F3N2O3 and a molecular weight of 445.22 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86877769 |
| Molecular Formula | C19H13Cl2F3N2O3 |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (Z)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(Cl)cc2Cl)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C19H13Cl2F3N2O3/c1-28-17-7-11(2-5-16(17)29-10-19(22,23)24)6-12(9-25)18(27)26-15-4-3-13(20)8-14(15)21/h2-8H,10H2,1H3,(H,26,27)/b12-6- |
| InChIKey | LAPGUSXCLZOJEX-SDQBBNPISA-N |
| XLogP | 5.49 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|