C26H17Cl3F3N3O4 — CID 3881090
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[4-[2-(2,6-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 3881090) has the molecular formula C26H17Cl3F3N3O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[4-[2-(2,6-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[4-[2-(2,6-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3881090 |
| Molecular Formula | C26H17Cl3F3N3O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyano-3-[4-[2-(2,6-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)ccc1OCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H17Cl3F3N3O4/c1-38-22-10-14(5-8-21(22)39-13-23(36)35-24-18(28)3-2-4-19(24)29)9-15(12-33)25(37)34-20-11-16(26(30,31)32)6-7-17(20)27/h2-11H,13H2,1H3,(H,34,37)(H,35,36) |
| InChIKey | BKDDREBXRFWBMJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|