C23H19F3N2O5 — CID 43012176
prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]prop-2-enoate (PubChem CID 43012176) has the molecular formula C23H19F3N2O5 and a molecular weight of 460.41 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]prop-2-enoate.
| Compound Name | prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 43012176 |
| Molecular Formula | C23H19F3N2O5 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1ccc(OCC(=O)Nc2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C23H19F3N2O5/c1-3-9-32-22(30)16(13-27)10-15-7-8-19(20(11-15)31-2)33-14-21(29)28-18-6-4-5-17(12-18)23(24,25)26/h3-8,10-12H,1,9,14H2,2H3,(H,28,29)/b16-10+ |
| InChIKey | RHPGCNOFGXNEHI-MHWRWJLKSA-N |
| XLogP | 4.37 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|