C24H19F3N4O4S — CID 3504215
2-cyano-3-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 3504215) has the molecular formula C24H19F3N4O4S and a molecular weight of 516.50 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3504215 |
| Molecular Formula | C24H19F3N4O4S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nccs2)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N4O4S/c1-2-34-20-11-15(10-16(13-28)22(33)31-23-29-8-9-36-23)6-7-19(20)35-14-21(32)30-18-5-3-4-17(12-18)24(25,26)27/h3-12H,2,14H2,1H3,(H,30,32)(H,29,31,33) |
| InChIKey | ODYQWCXEWNHBCE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|