C26H20F4N2O5S — CID 4319890
2-[4-[2-cyano-2-(4-fluorophenyl)sulfonylethenyl]-2-ethoxyphenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 4319890) has the molecular formula C26H20F4N2O5S and a molecular weight of 548.51 g/mol. Its IUPAC name is 2-[4-[2-cyano-2-(4-fluorophenyl)sulfonylethenyl]-2-ethoxyphenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[2-cyano-2-(4-fluorophenyl)sulfonylethenyl]-2-ethoxyphenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4319890 |
| Molecular Formula | C26H20F4N2O5S |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 2-[4-[2-cyano-2-(4-fluorophenyl)sulfonylethenyl]-2-ethoxyphenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1cc(C=C(C#N)S(=O)(=O)c2ccc(F)cc2)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F4N2O5S/c1-2-36-24-13-17(12-22(15-31)38(34,35)21-9-7-19(27)8-10-21)6-11-23(24)37-16-25(33)32-20-5-3-4-18(14-20)26(28,29)30/h3-14H,2,16H2,1H3,(H,32,33) |
| InChIKey | SRWZXCKDXBFHCE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|