C27H23F3N2O3 — CID 29154557
(E)-2-cyano-N-(2,6-dimethylphenyl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide (PubChem CID 29154557) has the molecular formula C27H23F3N2O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 29154557 |
| Molecular Formula | C27H23F3N2O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2c(C)cccc2C)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F3N2O3/c1-17-6-4-7-18(2)25(17)32-26(33)21(15-31)12-19-10-11-23(24(14-19)34-3)35-16-20-8-5-9-22(13-20)27(28,29)30/h4-14H,16H2,1-3H3,(H,32,33)/b21-12+ |
| InChIKey | LXYGVDSCRQVISR-CIAFOILYSA-N |
| XLogP | 6.46 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|