C25H21BrN2O2 — CID 2372395
(E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyano-N-(2,6-dimethylphenyl)prop-2-enamide (PubChem CID 2372395) has the molecular formula C25H21BrN2O2 and a molecular weight of 461.36 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyano-N-(2,6-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyano-N-(2,6-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2372395 |
| Molecular Formula | C25H21BrN2O2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyano-N-(2,6-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C(C#N)=C/c1ccc(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C25H21BrN2O2/c1-17-7-6-8-18(2)24(17)28-25(29)21(15-27)13-20-11-12-23(22(26)14-20)30-16-19-9-4-3-5-10-19/h3-14H,16H2,1-2H3,(H,28,29)/b21-13+ |
| InChIKey | QVWHODVXERSMBR-FYJGNVAPSA-N |
| XLogP | 6.19 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|