C19H16BrNO3 — CID 7321150
ethyl (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoate (PubChem CID 7321150) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is ethyl (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 7321150 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | ethyl (E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C19H16BrNO3/c1-2-23-19(22)16(12-21)10-15-8-9-18(17(20)11-15)24-13-14-6-4-3-5-7-14/h3-11H,2,13H2,1H3/b16-10+ |
| InChIKey | LSBUVAFYJICGIZ-MHWRWJLKSA-N |
| XLogP | 4.50 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|