C26H22N2O4 — CID 126054711
5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-phenylmethoxybenzoic acid (PubChem CID 126054711) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-phenylmethoxybenzoic acid.
| Compound Name | 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 126054711 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-phenylmethoxybenzoic acid |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2ccc(OCc3ccccc3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C26H22N2O4/c1-17-8-10-23(18(2)12-17)28-25(29)21(15-27)13-20-9-11-24(22(14-20)26(30)31)32-16-19-6-4-3-5-7-19/h3-14H,16H2,1-2H3,(H,28,29)(H,30,31)/b21-13- |
| InChIKey | SGFGHKFZEXNMOM-BKUYFWCQSA-N |
| XLogP | 5.13 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|