C26H27F3N2O3 — CID 6144697
(E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 6144697) has the molecular formula C26H27F3N2O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 6144697 |
| Molecular Formula | C26H27F3N2O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NC2CCCCC2C)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F3N2O3/c1-17-6-3-4-9-22(17)31-25(32)20(15-30)12-18-10-11-23(24(14-18)33-2)34-16-19-7-5-8-21(13-19)26(27,28)29/h5,7-8,10-14,17,22H,3-4,6,9,16H2,1-2H3,(H,31,32)/b20-12+ |
| InChIKey | CVEPLCGGEHYSOL-UDWIEESQSA-N |
| XLogP | 5.89 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|