C19H24N2O2 — CID 5349950
(E)-2-cyano-3-(3-methoxy-4-methylphenyl)-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 5349950) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-methoxy-4-methylphenyl)-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-methoxy-4-methylphenyl)-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 5349950 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (E)-2-cyano-3-(3-methoxy-4-methylphenyl)-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NC2CCCCC2C)ccc1C |
| InChI | InChI=1S/C19H24N2O2/c1-13-6-4-5-7-17(13)21-19(22)16(12-20)10-15-9-8-14(2)18(11-15)23-3/h8-11,13,17H,4-7H2,1-3H3,(H,21,22)/b16-10+ |
| InChIKey | FIHDLXVEQPKQMV-MHWRWJLKSA-N |
| XLogP | 3.61 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|