C21H27N3O5 — CID 9333906
(E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dimethoxyphenyl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 9333906) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dimethoxyphenyl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dimethoxyphenyl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 9333906 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3,5-dimethoxyphenyl]-2-cyano-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N[C@H]2CCCC[C@@H]2C)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C21H27N3O5/c1-13-6-4-5-7-16(13)24-21(26)15(11-22)8-14-9-17(27-2)20(18(10-14)28-3)29-12-19(23)25/h8-10,13,16H,4-7,12H2,1-3H3,(H2,23,25)(H,24,26)/b15-8+/t13-,16-/m0/s1 |
| InChIKey | RHSXTDHHYKCKDG-MMMMDWOWSA-N |
| XLogP | 2.17 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|