C28H34N4O2 — CID 4617152
2-cyano-3-[3-[2-cyano-3-[(2-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 4617152) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-cyano-3-[3-[2-cyano-3-[(2-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-[2-cyano-3-[(2-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 4617152 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-cyano-3-[3-[2-cyano-3-[(2-methylcyclohexyl)amino]-3-oxoprop-1-enyl]phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | CC1CCCCC1NC(=O)C(C#N)=Cc1cccc(C=C(C#N)C(=O)NC2CCCCC2C)c1 |
| InChI | InChI=1S/C28H34N4O2/c1-19-8-3-5-12-25(19)31-27(33)23(17-29)15-21-10-7-11-22(14-21)16-24(18-30)28(34)32-26-13-6-4-9-20(26)2/h7,10-11,14-16,19-20,25-26H,3-6,8-9,12-13H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | YEXSDQJWSVTYMB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|