C16H19N3O — CID 7040869
(E)-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 7040869) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (E)-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 7040869 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (E)-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)/C(C#N)=C/c1ccncc1 |
| InChI | InChI=1S/C16H19N3O/c1-12-4-2-3-5-15(12)19-16(20)14(11-17)10-13-6-8-18-9-7-13/h6-10,12,15H,2-5H2,1H3,(H,19,20)/b14-10+/t12-,15+/m0/s1 |
| InChIKey | XHWYLENSDCBWFE-UOWDCBNXSA-N |
| XLogP | 2.68 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|