C23H23ClN2O2 — CID 7689722
(E)-3-[3-(4-chlorophenoxy)phenyl]-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 7689722) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenoxy)phenyl]-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-[3-(4-chlorophenoxy)phenyl]-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 7689722 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (E)-3-[3-(4-chlorophenoxy)phenyl]-2-cyano-N-[(1R,2S)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)/C(C#N)=C/c1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-16-5-2-3-8-22(16)26-23(27)18(15-25)13-17-6-4-7-21(14-17)28-20-11-9-19(24)10-12-20/h4,6-7,9-14,16,22H,2-3,5,8H2,1H3,(H,26,27)/b18-13+/t16-,22+/m0/s1 |
| InChIKey | RDSOIRJYAXLBNM-RGLVEJBUSA-N |
| XLogP | 5.73 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|