C25H28N2O5S — CID 92965569
[4-[(Z)-2-cyano-3-[[(1R,2S)-2-methylcyclohexyl]amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 92965569) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[[(1R,2S)-2-methylcyclohexyl]amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-2-cyano-3-[[(1R,2S)-2-methylcyclohexyl]amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 92965569 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[[(1R,2S)-2-methylcyclohexyl]amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N[C@@H]2CCCC[C@@H]2C)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-17-8-11-21(12-9-17)33(29,30)32-23-13-10-19(15-24(23)31-3)14-20(16-26)25(28)27-22-7-5-4-6-18(22)2/h8-15,18,22H,4-7H2,1-3H3,(H,27,28)/b20-14-/t18-,22+/m0/s1 |
| InChIKey | ZWLSFUDMZGAPGI-SPWPFCJASA-N |
| XLogP | 4.37 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|