C22H21F3N2O3 — CID 29037178
(E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-propan-2-ylprop-2-enamide (PubChem CID 29037178) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 29037178 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-2-cyano-3-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-propan-2-ylprop-2-enamide |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)NC(C)C)cc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-14(2)27-21(28)17(12-26)9-15-7-8-19(29-3)20(11-15)30-13-16-5-4-6-18(10-16)22(23,24)25/h4-11,14H,13H2,1-3H3,(H,27,28)/b17-9+ |
| InChIKey | RCBYGSVRWGNXMA-RQZCQDPDSA-N |
| XLogP | 4.72 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|