C24H18Cl2N2O6 — CID 4000062
methyl 5-[[4-[2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 4000062) has the molecular formula C24H18Cl2N2O6 and a molecular weight of 501.32 g/mol. Its IUPAC name is methyl 5-[[4-[2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4000062 |
| Molecular Formula | C24H18Cl2N2O6 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | methyl 5-[[4-[2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C(C#N)C(=O)Nc3ccc(Cl)cc3Cl)cc2OC)o1 |
| InChI | InChI=1S/C24H18Cl2N2O6/c1-31-22-10-14(3-7-20(22)33-13-17-5-8-21(34-17)24(30)32-2)9-15(12-27)23(29)28-19-6-4-16(25)11-18(19)26/h3-11H,13H2,1-2H3,(H,28,29) |
| InChIKey | QAFFCRXYLAHSQU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|