C24H15Cl2N3O6 — CID 75409148
[4-[(Z)-3-(2-chloro-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 75409148) has the molecular formula C24H15Cl2N3O6 and a molecular weight of 512.31 g/mol. Its IUPAC name is [4-[(Z)-3-(2-chloro-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-3-(2-chloro-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 75409148 |
| Molecular Formula | C24H15Cl2N3O6 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | [4-[(Z)-3-(2-chloro-4-nitroanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl2N3O6/c1-34-22-11-14(2-9-21(22)35-24(31)15-3-5-17(25)6-4-15)10-16(13-27)23(30)28-20-8-7-18(29(32)33)12-19(20)26/h2-12H,1H3,(H,28,30)/b16-10- |
| InChIKey | TWBUQQIBVIJJAW-YBEGLDIGSA-N |
| XLogP | 5.68 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|